Senyawa 2 Metil 1 Pentanol Berisomer Dengan

By | 9 Agustus 2022

Pertanyaan dan pembahasan ilmu pisah karbon

  1. Senyawa 2-metil 1-pentanol berisomer dengan…
    1. metil propil eter
    2. dipropil eter
    3. isopentanol
    4. etil propil eter
    5. 3-pentanol
    6. Jawaban: b
      Alasan: Jumlah partikel C pada soal adalah 6. Pada jawaban, yang jumlah atom C-nya 6 adalah dipropil eter. Jumlah atom C untuk opsi: (a) 4, (b) 6, (c) 5, (d) 5, (e) 5

  2. Senyawa berikut yang bukan isomer berbunga C4H10O merupakan…

    1. dietil eter
    2. tersier butil alkohol
    3. dietil keton
    4. 2-metil 2-propanol
    5. metil propil eter
    6. Jawaban: c
      Alasaan: C4H10Udara murni merupakan gugus fungsi alkohol/ eter dan gugus alkanon (keton) bukan isomer dari alkohol ataupun eter.

  3. Sintesis berikut yang merupakan bandingan isomer…
    1. n-heksana dengan sikloheksana
    2. pentana dengan 2-metil butana
    3. butana dengan butuna
    4. propana dengan propena
    5. 2,3-dimetil pentena dengan 2-pentena
    6. Jawaban: b
      Alasan: Jumlah partikel C dan H sama. Siklo alkana berisomer dengan alkena, alkana tak berisomer dengan alkena.

  4. 2,2-dietil heksanal berisomer dengan…
    1. nonanal
    2. heptanal
    3. dekanal
    4. oktanal
    5. 3,3-dimetil heksanal
    6. Jawaban: c
      Alasan: 2,2-dietil heksanal mempunyai jumlah atom C sebanyak 10, jelas bahwa isomernya adalah dekanal.

  5. CH3-C(CH3)2-CHO berisomer dengan…
    1. CH3-CH2-CH2-CHO
    2. CH3-C(CH3)2-CH2-OH
    3. CH3-CH2-CH2-CH2-CHO
    4. CH3-CO-C2H5
    5. CH3-CH2-CH2-CH2-COOH
    6. Jawaban: c
      Alasan: CH3-C(CH3)2-CHO ialah gugus alkanal. Isomer dari alkanal adalah keton, cuma sreg opsi (d) jumlah unsur C-nya enggak sama. Jadi jawabannya yakni opsi c.

  6. Diketahui rumus struktur laksana berikut:

    (1) CH3CH
    2CH2CH2OH

    (2) CH3CH2CH(OH)CH3

    (3) CH3CH(CH3)CH2OH

    (4) C(CH3)3OH

    Yang yaitu isomer posisi dan juga isomer rangka yaitu…

    1. 1 dan 2
    2. 1 dan 3
    3. 2 dan 3
    4. 3 dan 4
    5. 4
    6. Jawaban: d
      Alasan: Isomer posisi merupakan isomer nan berbeda letak gugus fungsinya. Isomer buram ialah isomer yang berbeda strata rantainya (umumnya rantai verbatim dengan rantai cabang). Yang memenuhi semenjak signifikasi di atas adalah opsi d.

  7. Teman yang berisomer geometris yaitu…
    1. CH2BrCH2Br dan CH3CH2Br
    2. CHBrCHBr dan CH2CHBr
    3. CHBrCHBr dan BrCHCHBr
    4. C2H5COH dan C2H5CHO
    5. C2H5COOCH3
      dan CH3COOC2H5
    6. Jawaban: c
      Alasan: CHBrCHBr yakni isomer isomer chis dan BrCHCHBr isomer trans

  8. Nama senyawa CH2Br-CHI-CHCl2
    ialah…
    1. 1-bromo 3-kloro 2-iodo propana
    2. 3-bromo 1-kloro 2-iodo propana
    3. 1-bromo 3,3-dikloro 2-iodo propana
    4. 3-bromo 1,1-dikloro 2-iodo propana
    5. 1,2,3-tribromo kloro iodo propana
    6. Jawaban: d
      Alasan: Penomoran rantai diprioritaskan pada halogen yang paling reaktif (intern keadaan ini Cl) sehingga Cl berlambak pada rantai nomor 1.

  9. Dikloro metana dapat dibuat pecah metana dan klorin melalui reaksi…
    1. Substitusi
    2. netralisasi
    3. adisi
    4. redoks
    5. eliminasi
    6. Jawaban: a
      Alasan: bakal mendapatkan CH2Cl2
      diperlukan reaksi substitusi sebanyak 2 bisa jadi dari CH4
      nan dialiri asap Cl2
      dengan katalis kilap UV. Hasil berpunca reaksi ini adalah CH3Cl dan HCl. CH3Cl ini direaksikan pula dengan asap Cl2
      sehingga didapatkan CH2Cl2.

  10. Reaksi: CH3-CH=CH2
    + HCl menghasilkan…
    1. 2-kloro propana
    2. 3-kloro propana
    3. 1,3-dikloro propana
    4. 1-kloro propana
    5. 1,2-dikloro propana
    6. Jawaban: a
      Alasan: Kekeluargaan rangkap pada 1-propena akan pecah dan atom H pada HCl akan ki gandrung plong molekul C dengan perantaraan rangkap yang dari nan mengikat atom H terbanyak dan Cl terikat pada atom C dengan koalisi rangkap yang tak.

  11. Haloalkana yang rangkaian digunakan umpama pemadam kebakaran adalah…
    1. DDT
    2. C2H5Br
    3. bromo etana
    4. C2H5Cl
    5. CCl4
    6. Jawaban: e

  12. Fusi haloalkana yang digunakan ibarat zat anti septik lega luka yaitu…
    1. freon
    2. PVC
    3. kloroform
    4. iodoform
    5. DDT
    6. Jawaban: d

  13. Keunggulan senyawa berikut merupakan…
    1. 4-metil 2-kloro pentana
    2. 2-metil 4-kloro pentana
    3. 2,4-dikloro pentana
    4. 1,4-dikloro 2-metil pentana
    5. 1,3-dikloro pentana
    6. Jawaban: d
      Alasan: Gugus halogen diprioritaskan, karena pada rantai CH2Cl terdapat silang alkil (privat hal ini metil) maka puas rantai tersebut diberi nomor 1.

  14. Zat-zat berikut banyak digunakan kerumahtanggaan kehidupan sehari-hari. Zat yang mengandung unsur halogen adalah…
    1. freon
    2. sakarin
    3. vetsin
    4. tetoron
    5. urea
    6. Jawaban: a
      Alasan: Freon merupakan salah satu cagak dari CFC (Cloro Fluoro Carbon).

  15. Terdapat bilang jenis alkohol sebagai berikut:
  16. (1) 2-propanol

    (2) 2-metil 2-propanol

    (3) 3-pentanol

    (4) 2,2-dimetil propanol

    Paduan yang jika dioksidasi menghasilkan keton adalah…

    1. 1 dan 3
    2. 1 dan 2
    3. 1 dan 4
    4. 2 dan 3
    5. 2 dan 4
    6. Jawaban: a
      Alasan: Alkohol yang menghasilkan keton (alkanon) takdirnya dioksidasi ialah alkohol sekunder.

  17. Suatu senyawa C5H12Ozon dapat bereaksi dengan Na dan takdirnya dioksidasi akan menghasilkan zat nan dapat memerahkan lakmus. Fusi tersebut adalah…
    1. 1-pentanol
    2. 3-pentanol
    3. 3-metil 2-butanol
    4. 2-pentanol
    5. 2-metil 2-butanol
    6. Jawaban: a
      Alasan: Senyawa di atas yakni alkohol/ eter. Karena bisa bereaksi dengan logam Na, maka fusi tersebut adalah alkohol. Jikalau dioksidasi dapat memerahkan lakmus, berarti berkepribadian asam seandainya dioksidasi. Maka hasil oksidasinya adalah asam karboksilat (oksidasinya cermin). Bersut karboksilat tetapi dihasilkan dari oksidasi sempurna alkohol primer.

  18. Pada reaksi antara C2H5OH dengan besi Na proses nan terjadi ialah…
    1. substitusi OH oleh Na
    2. substitusi H yang terjerumus sreg Ozon maka dari itu Na
    3. substitusi H yang ki gandrung pada C oleh Na
    4. substitusi semua maka dari itu Na
    5. terputusnya ikatan antara kedua anasir C
    6. Jawaban: b
      Alasan: Reaksi substitusi tetapi menyebabkan pertukaran
      1 atom
      belaka. Pada reaksi di atas, H yang terpikat pada O digantikan oleh Na.

  19. Jika 2-butanol dioksidasi, zat yang terpelajar yaitu…
    1. propanon
    2. butanal
    3. aseton
    4. cemberut butanoat
    5. butanon
    6. Jawaban: e
      Alasan: 2-butanol adalah alkohol sekunder, maka jika dioksidasi akan menghasilkan keton dengan jumlah atom C nan sekelas dan letak gugus fungsi yang separas pula.

  20. Alkohol sekunder jika dioksidasi dengan kalium dikromat dalam suasana cemberut sulfat melemah, menghasilkan…
    1. keton
    2. alkena
    3. aldehid
    4. karbohidrat
    5. eter
    6. Jawaban: a

  21. Senyawa yang tertera alkohol polihidroksi yakni…
    1. etanol
    2. gliserol
    3. butanol
    4. eco
    5. protein
    6. Jawaban: b
      Alasan: Alkohol polihidroksi adalah alkohol yang mempunyai gugus -OH kian dari satu. Pada gliserol terdapat gugus -OH sebanyak 3. Bikin glikol terdapat -OH sebanyak 2.

  22. Suatu senyawa organik X memiliki Mr=60 dan mengandung 60% berat molekul C, 13,3% H dan 26,7% Udara murni. Takdirnya X dioksidasi menghasilkan cemberut karboksilat. Zat X tersebut adalah…
    1. asam asetat
    2. 1-propanol
    3. propanal
    4. 2-propanol
    5. propanon
    6. Jawaban:a

  23. Diantara senyawa berikut yang tergolong eter yakni…
    1. CH3CH(C2H5)COCH3
    2. (CH3)2CHCH(OH)C2H5
    3. CH3CH2
      CHO
    4. CH3
      OCOCH3
    5. CH2CHOCH3C2H5
    6. Jawaban: e
      Alasan: Gugus fungsi eter yakni -O-. (a) adalah gugus alkanon/ keton, (b) yaitu alkohol, (c) ialah aldehid, (d) ester, (e) eter.

  24. Bila dibandingkan sifat-sifat eter dengan alkohol yang sesuai adalah
    1. eter lebih mudah larut dalam air
    2. eter makin mudah ki amblas
    3. eter makin reaktif
    4. eter enggak bereaksi dengan PCl5
    5. eter tidak terbakar
    6. Jawaban: b
      Alasan: Titik didih eter lebih rendah daripada alkohol

  25. Senyawa berikut nan dapat digunakan sebagai obat bius yakni…
    1. metanol
    2. gliserol
    3. etanol
    4. dietil eter
    5. glikol
    6. Jawaban: d

  26. senyawa A (C4H10O) tidak bereaksi dengan logam Na. Senyawa A dengan larutan HI berlebih menghasilkan sintesis B, C dan H2Udara murni. Hidrolisis senyawa C menghasilkan 2-propanol. Senyawa A tersebut yaitu…
    1. metil isopropil eter
    2. tersier butil alkohol
    3. metil n-propil eter
    4. isobutil alkohol
    5. sekunder butli alkohol
    6. Jawaban: a
      Alasan: Senyawa A enggak bereaksi dengan Na, menunjukkan bahwa paduan A ialah senyawa eter. Eter jika bereaksi dengan HI berlebih, akan menghasilkan R-I, R’-I, dan H2O. Hasil hidrolisisnya adalah 2-propanol (alkohol sekunder), jadi yang dihidrolisis ialah R-I. Karena akhirnya yaitu alkohol sekunder, maka R=isopropil. Sisa atom C sebanyak 1. Jadi nama senyawa eter tersebut adalah metil isopropil eter.

  27. Tanda campuran berikut adalah…

    1. 2,2-dimetil 3,3-dietil butanal
    2. 2,2-dietil 3,3-dimetil butanal
    3. 2,3-dietil 2,3-dimetil butanal
    4. 3-etil 4,4-dimetil pentanal
    5. 3,4-dietil 2,3-dimetil pentanal
    6. Jawaban: b

  28. 2-metil pentanal bisa dibuat dengan mengoksidasi sintesis…
    1. 1-pentanol
    2. 2-metil 1-pentanol
    3. 2-metil 1-butanol
    4. 2-metil 2-pentanol
    5. 3-metil 1-pentanol
    6. Jawaban: b
      Alasan: Sintesis puas soal yakni aldehid. Aldehid hanya dihasilkan dari oksidasi segmental alkohol primer dengan besaran atom C nan setimpal.

  29. Seseorang nan menderita penyakit kencing manis melitus, air kencingnya jika diuji dengan menggunakan larutan Fehling karena gula mengandung gugus…
    1. alkohol
    2. eter
    3. alkanoat
    4. alkanon
    5. alkanal
    6. Jawaban: e

  30. Hancuran aldehid yang digunakan bikin mengawetkan dabat percobaan ialah…
    1. formalin
    2. asam asetat
    3. senderut formiat
    4. aseton
    5. alkohol
    6. Jawaban: a

  31. Aldehid dan keton punya gugus keefektifan nan sekelas, yaitu…
    1. gugus hidroksil
    2. gugus karbinol
    3. karboksilat
    4. gugus karbonil
    5. gugus amina
    6. Jawaban: d
      Alasan: Gugus karbonil adalah gugus di mana perikatan unsur C rangkap terhadap elemen O. Sedangkan gugus karbinol merupakan gugus di mana jalinan elemen C tunggal terhada zarah O.

  32. Tanda senyawa CH3CH(C2H5)CHO yaitu…
    1. 2-etil propanal
    2. 2-etil 1-propanal
    3. 2-metil butanal
    4. 3-metil butanal
    5. 2-etil butanal
    6. Jawaban: c

  33. Nama senyawa berikut adalah…

    1. 1,1-dimetil 2-butanon
    2. 4,4-dimetil 2-butanon
    3. 4-metil 2-pentanon
    4. 2-metil 4-pentanon
    5. isopropil metil keton
    6. Jawaban: c

  34. Nama senyawa: CH3C(CH3)(C2H5)COC(CH3)2(C2H5) yakni…
    1. 2,4-dietil 2,4 dimetil 3-pentanon
    2. 2,2-dietil 4,4-dimetil 3-pentanon
    3. 3,3,5,5-tetrametil 4-heptanon
    4. 3,3-dietil 5,5-dimetil 4-heptanon
    5. 3,5-dietil 3,5-dimetil 3-heptanon
    6. Jawaban: c

  35. Keton dapat dibuat dengan cara mengoksdasi…
    1. alkohol primer
    2. asam karboksilat
    3. ester
    4. alkohol sekunder
    5. aldehid
    6. Jawaban: d

  36. Senyawa dengan rumus: CH3-CH2-CO-CH3
    dihasilkan dari reaksi oksidasi zat A. Zat A tersebut adalah…
    1. CH3-CH2-CH2-CHO
    2. CH3-CH2-CHOH-CH3
    3. CH3-CH2-Udara murni-CH2-CH3
    4. CH3-CH2-CH2OH
    5. CH3-CH2-CH2-COOH
    6. Jawaban: b
      Alasan: Keton ialah hasil oksidasi parsial alkohol sekunder

  37. Senyawa dengan rumus molekul C5H10Ozon memiliki isomer berupa aldehid dan keton yang masing-masing berjumlah…
    1. 4 dan 3
    2. 3 dan 4
    3. 5 dan 4
    4. 4 dan 5
    5. 4 dan 4
    6. Jawaban: a
      Alasan: Total aldehid=4 (pentanal, 2-metil butanal, 3-metil butanal, 2,2-dimetil propanal) dan jumlah keton=3 (2-pentanon, 3-pentanon, 3-metil 2-pentanon)

  38. Korting aseton menghasilkan…
    1. asam asetat
    2. asetaldehid
    3. propil alkohol
    4. isopropil alkohol
    5. etanol
    6. Jawaban: d
      Alasan: Aseton (2-propanon) jika direduksi akan menghasilkan 2-propanol ataupun isopropil alkohol.

  39. Nama sintesis berikut yakni…

    1. asam 2,4-dietil 2-metil pentanoat
    2. cemberut 2,4-dietil 4-metil pentanoat
    3. asam 2-etil 2,4-dimetil heksanoat
    4. bersut 4-etil 2,4-dimetil heksanoat
    5. senderut 4-etil 4-metil heksanoat
    6. Jawaban: c

  40. Seandainya 1,1 gram asam organik (R-COOH) tepat dinetralkan maka itu 50 ml enceran NaOH 0,25 M, maka cemberut organik tersebut adalah…
    1. senderut asetat
    2. asam butanoat
    3. asam heksanoat
    4. senderut propanoat
    5. senderut pentanoat
    6. Jawaban:

  41. Asam propionat bisa dibuat dengan mengoksidasi…
    1. CH3
      COCH3
    2. CH2
      OHCH2CH2
      OH
    3. CH3CH2
      OH
    4. CH3CHOHCH3
    5. CH3CH2
      CHO
    6. Jawaban: e
      Alasan: Bersut propionat merupakan hasil oksidasi dari aldehid

  42. Asam asetat tidak digunakan cak bagi…
    1. mengatur keasaman pada nafkah
    2. mengawetkan makanan
    3. pembuatan sasaran mega
    4. target protokoler pembuatan serat
    5. korban baku pembuatan parfum dan esen biji pelir-buahan
    6. Jawaban: e
      Alasan: ester ialah incaran protokoler pembuatan parfum dan esen buah-buahan

  43. Keunggulan senyawa berikut adalah…

    1. cemberut 1,2,3-trihidroksi 1,2-pentadioat
    2. bersut 2,3,4-trihidroksi 1,5-pentadioat
    3. asam 1,2,3-triol 1,2-dipentanoat
    4. asam 2,3,4-triol 1,2-dipentanoat
    5. Asam trihidroksi pentadioat
    6. Jawaban: b

  44. Senyawa C4H8Ozon2
    nan bertabiat asam berjumlah…
    1. 1
    2. 2
    3. 3
    4. 4
    5. 5
    6. Jawaban: b
      Alasan: Senyawa diatas nan bertabiat asam yakni cemberut alkanoat (asam butanoat dan senderut 2-metil propanoat)

  45. Senyawa organik yang tersurat golongan senyawa ester adalah…
    1. metil asetat
    2. metil etil eter
    3. 2-metil butanal
    4. metil amina
    5. 3-metil butanal
    6. Jawaban: a

  46. Campuran yang hasil reaksinya nyata ester adalah…
    1. propanol dan natrium
    2. gliserol treiolet dan kaustik soda
    3. bersut oleat dan natrium hidroksida
    4. propanol dan fosfor trioksida
    5. etanol dan asam asetat
    6. Jawaban: e
      Alasan: Ester dapat dibuat dari alkohol dan asam alkanoat melalui proses esterifikasi yang menghasilkan ester dan air. Reaksi ini dapat wara wiri.

  47. Hidrolisis butil asetat dalam suasana asam menghasilkan…
    1. butanol dan bersut etanoat
    2. etanol dan asam butanoat
    3. butanol dan etanol
    4. asam etanoat dan asam butanoat
    5. butanol dan aseton
    6. Jawaban: a
      Alasan: (sama dengan nomor sebelumnya)

  48. Zat berikut yang tidak termasuk golongan ester adalah…
    1. minyak goreng
    2. esens mauz
    3. gula putih
    4. sarang lebah
    5. gurih kambig
    6. Jawaban:

  49. Merek senyawa berikut adalah…

    1. 2,5 dimetil 3-pentanon
    2. diisopropil keton
    3. diisopropil ester
    4. isobutil propanoat
    5. isopropil isobutirat
    6. Jawaban: c

  50. Reaksi berikut disebut reaksi…


    1. netralisasi
    2. penyabunan
    3. hidrolisis
    4. dekomposisi
    5. esterifikasi
    6. Jawaban: c

  51. Hidrolisis etil propionat menghasilkan…
    1. propil alkohol dan asam etanoat
    2. cemberut etanoat dan etil alkohol
    3. isopropil alkohol dan asam etanoat
    4. bersut asetat dan asam propionat
    5. etanol dan asam propionat
    6. Jawaban: b

Untuk tanya-soal selanjutnya akan diposting kemudian karena butuh tahun nan cukup lama buat mengetik pertanyaan-tanya di atas dan sisanya. Minta lepas.

Senyawa 2 Metil 1 Pentanol Berisomer Dengan

Source: http://pendidikan-ipa.blogspot.com/2010/01/jawaban-kimia.html

Baca juga:   Tuliskan Persamaan Garis Yang Ditunjukkan Tiap Tiap Gambar Berikut